* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | DIETHYL ACETAMIDOMALONATE-1,2,3-13C3 |
| EnglishSynonyms: | DIETHYL ACETAMIDOMALONATE-1,2,3-13C3 |
| pro_mdlNumber: | MFCD16621440 |
| pro_acceptors: | 6 |
| pro_donors: | 1 |
| pro_smile: | CCO[13C](=O)[13CH]([13C](=O)OCC)NC(=O)C |
| InChi: | InChI=1S/C9H15NO5/c1-4-14-8(12)7(10-6(3)11)9(13)15-5-2/h7H,4-5H2,1-3H3,(H,10,11)/i7+1,8+1,9+1 |
| InChiKey: | InChIKey=ISOLMABRZPQKOV-ULEDQSHZSA-N |
|
|
| MeltingPoint: | 95-98 DEG C(LIT) |
| Comments: | ASSAY METHOD: CP MASS SHIFT: M+3 WGK: 1 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 220.17 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.