* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | 6H-PURINE-6-THIONE, 1,7-DIHYDRO-, 9-OXIDE |
CAS: | 856611-14-8 |
EnglishSynonyms: | 6H-PURINE-6-THIONE, 1,7-DIHYDRO-, 9-OXIDE |
pro_mdlNumber: | MFCD16878167 |
pro_acceptors: | 5 |
pro_donors: | 2 |
pro_smile: | c1[nH]c(=S)c2c(n1)[n+](c[nH]2)[O-] |
InChi: | InChI=1S/C5H4N4OS/c10-9-2-8-3-4(9)6-1-7-5(3)11/h1-2,8H,(H,6,7,11) |
InChiKey: | InChIKey=LFQPKVYEVSPWND-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.