* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 1,4-DIOXANE-2,5-DIONE, 3-METHYL-6-(2-PROPENYL)- |
| CAS: | 862374-91-2 |
| EnglishSynonyms: | 3-METHYL-6-(PROP-2-EN-1-YL)-1,4-DIOXANE-2,5-DIONE ; 1,4-DIOXANE-2,5-DIONE, 3-METHYL-6-(2-PROPENYL)- ; 3-METHYL-6-(2-PROPENYL)-1,4-DIOXANE-2,5-DIONE |
| pro_mdlNumber: | MFCD16878514 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | CC1C(=O)OC(C(=O)O1)CC=C |
| InChi: | InChI=1S/C8H10O4/c1-3-4-6-8(10)11-5(2)7(9)12-6/h3,5-6H,1,4H2,2H3 |
| InChiKey: | InChIKey=MEJWTGVMNYEBMC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.