* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | METHYL 3-AMINO-4-(1H-PYRROL-1-YL)BENZOATE |
| EnglishSynonyms: | METHYL 3-AMINO-4-(1H-PYRROL-1-YL)BENZOATE |
| pro_mdlNumber: | MFCD16890131 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | COC(=O)c1ccc(c(c1)N)n2cccc2 |
| InChi: | InChI=1S/C12H12N2O2/c1-16-12(15)9-4-5-11(10(13)8-9)14-6-2-3-7-14/h2-8H,13H2,1H3 |
| InChiKey: | InChIKey=XGNKITGOYJEYDZ-UHFFFAOYSA-N |
|
|
| MeltingPoint: | 88-90 DEG |
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.