* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | TRANS-9-HEXADECENOIC ACID-1,2,3,7,8-13C5 |
| CAS: | 1255644-44-0 |
| EnglishSynonyms: | TRANS-9-HEXADECENOIC ACID-1,2,3,7,8-13C5 ; PALMITELAIDIC ACID-1,2,3,7,8-13C5 |
| pro_mdlNumber: | MFCD17015276 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CCCCCC/C=C/[13CH2][13CH2]CCC[13CH2][13CH2][13C](=O)O |
| InChi: | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/b8-7+/i9+1,10+1,14+1,15+1,16+1 |
| InChiKey: | InChIKey=SECPZKHBENQXJG-JUEUFVFDSA-N |
|
|
| Comments: | ASSAY METHOD: CP MASS SHIFT: M+5 WGK: 1 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 259.32 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.