* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX100282-001 |
EnglishSynonyms: | WUXIAPPTEC WX100282-010 ; WUXIAPPTEC WX100282-005 ; WUXIAPPTEC WX100282-001 |
pro_mdlNumber: | MFCD17016161 |
pro_acceptors: | 4 |
pro_donors: | 2 |
pro_smile: | CC(C)(C)OC(=O)NC1CCC2(CCC(N)CC2)CC1 |
InChi: | InChI=1S/C16H30N2O2/c1-15(2,3)20-14(19)18-13-6-10-16(11-7-13)8-4-12(17)5-9-16/h12-13H,4-11,17H2,1-3H3,(H,18,19) |
InChiKey: | InChIKey=ZBGVFGCHEQPGNU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.