* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX110227-001 |
EnglishSynonyms: | WUXIAPPTEC WX110227-005 ; WUXIAPPTEC WX110227-001 ; WUXIAPPTEC WX110227-010 |
pro_mdlNumber: | MFCD17016480 |
pro_acceptors: | 6 |
pro_donors: | 1 |
pro_smile: | [H][C@@]12CCC[C@@H](N1CCN(C2)C(=O)OC(C)(C)C)C(O)=O |
InChi: | InChI=1S/C14H24N2O4/c1-14(2,3)20-13(19)15-7-8-16-10(9-15)5-4-6-11(16)12(17)18/h10-11H,4-9H2,1-3H3,(H,17,18)/t10-,11+/m0/s1 |
InChiKey: | InChIKey=AAAILMFNBJLVNE-WDEREUQCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.