* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX115062-001 |
EnglishSynonyms: | WUXIAPPTEC WX115062-001 ; WUXIAPPTEC WX115062-005 ; WUXIAPPTEC WX115062-010 |
pro_mdlNumber: | MFCD17016557 |
pro_acceptors: | 4 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1C[C@H]2CC(F)(F)[C@@H]3CNC[C@]23C1 |
InChi: | InChI=1S/C14H22F2N2O2/c1-12(2,3)20-11(19)18-6-9-4-14(15,16)10-5-17-7-13(9,10)8-18/h9-10,17H,4-8H2,1-3H3/t9-,10-,13+/m1/s1 |
InChiKey: | InChIKey=VOYHTRPKSRLRNA-BREBYQMCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.