* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX115173-001 |
EnglishSynonyms: | WUXIAPPTEC WX115173-010 ; WUXIAPPTEC WX115173-005 ; WUXIAPPTEC WX115173-001 |
pro_mdlNumber: | MFCD17016644 |
pro_acceptors: | 5 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1C[C@@H]2OCCNC[C@@]2(C1)C1=CC=CC=C1 |
InChi: | InChI=1S/C18H26N2O3/c1-17(2,3)23-16(21)20-11-15-18(13-20,12-19-9-10-22-15)14-7-5-4-6-8-14/h4-8,15,19H,9-13H2,1-3H3/t15-,18+/m0/s1 |
InChiKey: | InChIKey=RMLZHGANYHNTFK-MAUKXSAKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.