* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX115183-001 |
EnglishSynonyms: | WUXIAPPTEC WX115183-001 ; WUXIAPPTEC WX115183-005 ; WUXIAPPTEC WX115183-010 |
pro_mdlNumber: | MFCD17016652 |
pro_acceptors: | 5 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CC[C@@]2(OCCNC[C@@H]2C1)C1=CC=CC=C1 |
InChi: | InChI=1S/C19H28N2O3/c1-18(2,3)24-17(22)21-11-9-19(15-7-5-4-6-8-15)16(14-21)13-20-10-12-23-19/h4-8,16,20H,9-14H2,1-3H3/t16-,19-/m1/s1 |
InChiKey: | InChIKey=CXYAPUPMXMVXBB-VQIMIIECSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.