* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX125066-001 |
EnglishSynonyms: | WUXIAPPTEC WX125066-001 ; WUXIAPPTEC WX125066-010 ; WUXIAPPTEC WX125066-005 |
pro_mdlNumber: | MFCD17016855 |
pro_acceptors: | 8 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CC2CC3=C(N=CN3)C(C1)N2C(=O)OCC1=CC=CC=C1 |
InChi: | InChI=1S/C21H26N4O4/c1-21(2,3)29-19(26)24-10-15-9-16-18(23-13-22-16)17(11-24)25(15)20(27)28-12-14-7-5-4-6-8-14/h4-8,13,15,17H,9-12H2,1-3H3,(H,22,23) |
InChiKey: | InChIKey=XJWATGRBILLJDD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.