* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX140109-001 |
EnglishSynonyms: | WUXIAPPTEC WX140109-005 ; WUXIAPPTEC WX140109-010 ; WUXIAPPTEC WX140109-001 |
pro_mdlNumber: | MFCD17017174 |
pro_acceptors: | 5 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CCCC2=C1N=C(CN)S2 |
InChi: | InChI=1S/C12H19N3O2S/c1-12(2,3)17-11(16)15-6-4-5-8-10(15)14-9(7-13)18-8/h4-7,13H2,1-3H3 |
InChiKey: | InChIKey=MYLFQCSDCYCHHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.