* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX110318-001 |
EnglishSynonyms: | WUXIAPPTEC WX110318-010 ; WUXIAPPTEC WX110318-001 ; WUXIAPPTEC WX110318-005 |
pro_mdlNumber: | MFCD17017199 |
pro_acceptors: | 5 |
pro_donors: | 2 |
pro_smile: | CC(C)(C)OC(=O)N1C2CNC2CC1CO |
InChi: | InChI=1S/C11H20N2O3/c1-11(2,3)16-10(15)13-7(6-14)4-8-9(13)5-12-8/h7-9,12,14H,4-6H2,1-3H3 |
InChiKey: | InChIKey=AYGXQNSVNVOZFW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.