* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX110321-001 |
EnglishSynonyms: | WUXIAPPTEC WX110321-001 ; WUXIAPPTEC WX110321-010 ; WUXIAPPTEC WX110321-005 |
pro_mdlNumber: | MFCD17017209 |
pro_acceptors: | 4 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CCC2(CN)CCCC12 |
InChi: | InChI=1S/C13H24N2O2/c1-12(2,3)17-11(16)15-8-7-13(9-14)6-4-5-10(13)15/h10H,4-9,14H2,1-3H3 |
InChiKey: | InChIKey=GRGFPDOJMTZTIH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.