* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX145132-001 |
EnglishSynonyms: | WUXIAPPTEC WX145132-005 ; WUXIAPPTEC WX145132-001 ; WUXIAPPTEC WX145132-010 |
pro_mdlNumber: | MFCD17017320 |
pro_acceptors: | 5 |
pro_donors: | 1 |
pro_smile: | OC(=O)C1CCN2C(C1)=NC1=C2N=C(Cl)C=C1 |
InChi: | InChI=1S/C11H10ClN3O2/c12-8-2-1-7-10(14-8)15-4-3-6(11(16)17)5-9(15)13-7/h1-2,6H,3-5H2,(H,16,17) |
InChiKey: | InChIKey=SCDONURZABCZTL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.