* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX110350-001 |
EnglishSynonyms: | WUXIAPPTEC WX110350-010 ; WUXIAPPTEC WX110350-001 ; WUXIAPPTEC WX110350-005 |
pro_mdlNumber: | MFCD17017475 |
pro_acceptors: | 4 |
pro_donors: | 0 |
pro_smile: | [H][C@]12CCC(=O)[C@@]1([H])OC(C2)C(=O)OCC |
InChi: | InChI=1S/C10H14O4/c1-2-13-10(12)8-5-6-3-4-7(11)9(6)14-8/h6,8-9H,2-5H2,1H3/t6-,8?,9+/m1/s1 |
InChiKey: | InChIKey=KJRPOONSMXTNHN-MSSDQNSGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.