* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | CB-DMB |
| EnglishSynonyms: | CB-DMB |
| pro_mdlNumber: | MFCD17215951 |
| pro_acceptors: | 8 |
| pro_donors: | 5 |
| pro_smile: | Cc1ccc(c(c1)C)CNC(=N)NC(=O)c2c(nc(c(n2)Cl)NCc3ccc(cc3)Cl)N |
| InChi: | InChI=1S/C22H23Cl2N7O/c1-12-3-6-15(13(2)9-12)11-28-22(26)31-21(32)17-19(25)30-20(18(24)29-17)27-10-14-4-7-16(23)8-5-14/h3-9H,10-11H2,1-2H3,(H3,25,27,30)(H3,26,28,31,32) |
| InChiKey: | InChIKey=MGLQFHOCPGELNL-UHFFFAOYSA-N |
|
|
|
|
| secure_symbol: |
GHS07
|
| secure_signal_word: | Warning |
| secure_risk_stmt: | H302-H319 |
| secure_cautionary_stmt: | P305 + P351 + P338 |
| secure_damage_code: | Xn |
| secure_risk_disclosure_stmt: | R:22-36 |
| secure_security_stmt: | S:26 |
| secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.