* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 8,8'-BIS(DIPHENYLPHOSPHINO)-3,3',4,4'-TETRAHYDRO-4,4,4',4',6,6'-HEXAMETHYL-2,2'-SPIROBI[2H-1-BENZOPYRAN] |
| CAS: | 556797-94-5 |
| EnglishSynonyms: | 8,8'-BIS(DIPHENYLPHOSPHINO)-3,3',4,4'-TETRAHYDRO-4,4,4',4',6,6'-HEXAMETHYL-2,2'-SPIROBI[2H-1-BENZOPYRAN] ; SPANPHOS |
| pro_mdlNumber: | MFCD18827638 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | Cc1cc2c(c(c1)P(c3ccccc3)c4ccccc4)OC5(CC2(C)C)CC(c6cc(cc(c6O5)P(c7ccccc7)c8ccccc8)C)(C)C |
| InChi: | InChI=1S/C47H46O2P2/c1-33-27-39-43(41(29-33)50(35-19-11-7-12-20-35)36-21-13-8-14-22-36)48-47(31-45(39,3)4)32-46(5,6)40-28-34(2)30-42(44(40)49-47)51(37-23-15-9-16-24-37)38-25-17-10-18-26-38/h7-30H,31-32H2,1-6H3 |
| InChiKey: | InChIKey=RQMTZMWXNZQOPD-UHFFFAOYSA-N |
|
|
| Comments: | FORM: WHITE POWDER |
| Information: | RACEMIC |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.