* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WAY 207024 DIHYDROCHLORIDE |
| CAS: | 872002-73-8 |
| EnglishSynonyms: | WAY 207024 DIHYDROCHLORIDE |
| pro_mdlNumber: | MFCD19690918 |
| pro_acceptors: | 6 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)c1ccc(cc1)c2[nH]c3cc(ccc3n2)N4CCN(CC4)Cc5ccc6c(c5)nccn6.Cl.Cl |
| InChi: | InChI=1S/C30H32N6.2ClH/c1-30(2,3)23-7-5-22(6-8-23)29-33-26-11-9-24(19-28(26)34-29)36-16-14-35(15-17-36)20-21-4-10-25-27(18-21)32-13-12-31-25;;/h4-13,18-19H,14-17,20H2,1-3H3,(H,33,34);2*1H |
| InChiKey: | InChIKey=HUWRWFMDFKADHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.