* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | JNJ 5207852 DIHYDROCHLORIDE |
CAS: | 398473-34-2 |
EnglishSynonyms: | JNJ 5207852 DIHYDROCHLORIDE |
pro_mdlNumber: | MFCD19690931 |
pro_acceptors: | 3 |
pro_donors: | 0 |
pro_smile: | c1cc(ccc1CN2CCCCC2)OCCCN3CCCCC3.Cl.Cl |
InChi: | InChI=1S/C20H32N2O.2ClH/c1-3-12-21(13-4-1)16-7-17-23-20-10-8-19(9-11-20)18-22-14-5-2-6-15-22;;/h8-11H,1-7,12-18H2;2*1H |
InChiKey: | InChIKey=RLLXSVVZCGBIJR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.