* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RO 3280 |
CAS: | 1062243-51-9 |
EnglishSynonyms: | RO 3280 ; RO3280 |
pro_mdlNumber: | MFCD22665717 |
pro_acceptors: | 10 |
pro_donors: | 2 |
pro_smile: | CN1CCC(CC1)NC(=O)c2ccc(c(c2)OC)Nc3ncc4c(n3)N(CC(C(=O)N4C)(F)F)C5CCCC5 |
InChi: | InChI=1S/C27H35F2N7O3/c1-34-12-10-18(11-13-34)31-24(37)17-8-9-20(22(14-17)39-3)32-26-30-15-21-23(33-26)36(19-6-4-5-7-19)16-27(28,29)25(38)35(21)2/h8-9,14-15,18-19H,4-7,10-13,16H2,1-3H3,(H,31,37)(H,30,32,33) |
InChiKey: | InChIKey=DJNZZLZKAXGMMC-UHFFFAOYSA-N |
property |
|
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.