* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | Q 18 2-HYDROXY-3-(2-HYDROXY-3-METHYL-3-BUTEN-1-YL)-1,4-NAPHTHOQUINONE |
| CAS: | 74693-74-6 |
| EnglishSynonyms: | Q 18 2-HYDROXY-3-(2-HYDROXY-3-METHYL-3-BUTEN-1-YL)-1,4-NAPHTHOQUINONE |
| pro_mdlNumber: | MFCD00019575 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | CC(=C)C(CC1=C(C(=O)c2ccccc2C1=O)O)O |
| InChi: | InChI=1S/C15H14O4/c1-8(2)12(16)7-11-13(17)9-5-3-4-6-10(9)14(18)15(11)19/h3-6,12,16,19H,1,7H2,2H3 |
| InChiKey: | InChIKey=RXHSXAQBGXUFRA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.