* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 8,19-EPOXY-5-HO-20-OXO-5-B-PREGNANE-3-B,19,21-TRIYL 3,21-DIACETATE 19-ME ETHER |
| EnglishSynonyms: | 8,19-EPOXY-5-HO-20-OXO-5-B-PREGNANE-3-B,19,21-TRIYL 3,21-DIACETATE 19-ME ETHER |
| pro_mdlNumber: | MFCD00670719 |
| pro_acceptors: | 8 |
| pro_donors: | 1 |
| pro_smile: | CC(=O)OCC(=O)C1CCC2C1(CCC3[C@@]24CCC5([C@]3(CCC(C5)OC(=O)C)C(O4)OC)O)C |
| InChi: | InChI=1S/C26H38O8/c1-15(27)32-14-19(29)18-5-6-20-23(18,3)9-8-21-25-10-7-17(33-16(2)28)13-24(25,30)11-12-26(20,21)34-22(25)31-4/h17-18,20-22,30H,5-14H2,1-4H3/t17?,18?,20?,21?,22?,23?,24?,25-,26+/m0/s1 |
| InChiKey: | InChIKey=KEOOAUOUZQFIKC-FTOSCAIRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.