* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | VAT BROWN 5, SOLUBILISED |
| EnglishSynonyms: | VAT BROWN 5, SOLUBILISED |
| pro_mdlNumber: | MFCD01740397 |
| pro_acceptors: | 8 |
| pro_donors: | 0 |
| pro_smile: | c1ccc2c(c1)ccc3c2c(c(s3)c4c(c5c6ccccc6ccc5s4)OS(=O)(=O)[O-])OS(=O)(=O)[O-].[Na+].[Na+] |
| InChi: | InChI=1S/C24H14O8S4.2Na/c25-35(26,27)31-21-19-15-7-3-1-5-13(15)9-11-17(19)33-23(21)24-22(32-36(28,29)30)20-16-8-4-2-6-14(16)10-12-18(20)34-24;;/h1-12H,(H,25,26,27)(H,28,29,30);;/q;2*+1/p-2 |
| InChiKey: | InChIKey=QEUFEMFUODMTPB-UHFFFAOYSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.