* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM GT HW 2742 |
| EnglishSynonyms: | RARECHEM GT HW 2742 |
| pro_mdlNumber: | MFCD03043792 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | CN(C)c1cccc2c1cccc2S(=O)(=O)NCCCO |
| InChi: | InChI=1S/C15H20N2O3S/c1-17(2)14-8-3-7-13-12(14)6-4-9-15(13)21(19,20)16-10-5-11-18/h3-4,6-9,16,18H,5,10-11H2,1-2H3 |
| InChiKey: | InChIKey=LZBOWNLGEMJCJR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.