* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | GYKI 52466 DIHYDROCHLORIDE |
CAS: | 102771-26-6 |
EnglishSynonyms: | GYKI 52466 DIHYDROCHLORIDE |
pro_mdlNumber: | MFCD03453303 |
pro_acceptors: | 5 |
pro_donors: | 1 |
pro_smile: | CC1=NN=C(c2cc3c(cc2C1)OCO3)c4ccc(cc4)N.Cl.Cl |
InChi: | InChI=1S/C17H15N3O2.2ClH/c1-10-6-12-7-15-16(22-9-21-15)8-14(12)17(20-19-10)11-2-4-13(18)5-3-11;;/h2-5,7-8H,6,9,18H2,1H3;2*1H |
InChiKey: | InChIKey=NDRITPLSHUPVRR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.