* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | GALLIUM CITRATE GA-67 |
| CAS: | 41183-64-6 |
| EnglishSynonyms: | GALLIUM CITRATE GA-67 |
| pro_mdlNumber: | MFCD08067725 |
| pro_acceptors: | 7 |
| pro_donors: | 1 |
| pro_smile: | C1C(=O)O[67Ga]2OC(=O)CC1(C(=O)O2)O |
| InChi: | InChI=1S/C6H8O7.Ga/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;+3/p-3/i;1-3 |
| InChiKey: | InChIKey=YEEGWNXDUZONAA-RYDPDVNUSA-K |
* If the product has intellectual property rights, a license granted is must or contact us.