* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | URACIL-13C-15N2 |
| EnglishSynonyms: | 2,4-PYRIMIDINEDIOL-13C,15N2 ; URACIL-13C-15N2 ; 2,4(1H,3H)-PYRIMIDINEDIONE-13C,15N2 ; 4-HYDROXYURACIL-13C,15N2 ; 2,4-PYRIMIDINEDIONE-13C,15N2 ; HYBAR X-13C,15N2 ; 2,4-DIHYDROXYPYRIMIDINE-13C,15N2 ; 2,4-DIOXOPYRIMIDINE-13C,15N2 |
| pro_mdlNumber: | MFCD09841402 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | c1c[15nH]c(=O)[15nH][13c]1=O |
| InChi: | InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8)/i3+1,5+1,6+1 |
| InChiKey: | InChIKey=ISAKRJDGNUQOIC-GDTGSDDISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.