* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM GT HW 3442 |
| EnglishSynonyms: | RARECHEM GT HW 3442 |
| pro_mdlNumber: | MFCD23159033 |
| pro_acceptors: | 4 |
| pro_donors: | 3 |
| pro_smile: | CSC1NC(=CC(=O)N1)CO |
| InChi: | InChI=1S/C6H10N2O2S/c1-11-6-7-4(3-9)2-5(10)8-6/h2,6-7,9H,3H2,1H3,(H,8,10) |
| InChiKey: | InChIKey=ZUPOMGVUXIXNIO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.