* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM GT HW 3484 |
| EnglishSynonyms: | RARECHEM GT HW 3484 |
| pro_mdlNumber: | MFCD23159040 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | Cc1ccc(c(n1)CO)F |
| InChi: | InChI=1S/C7H8FNO/c1-5-2-3-6(8)7(4-10)9-5/h2-3,10H,4H2,1H3 |
| InChiKey: | InChIKey=KFDNOUGIKZYLPY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.