* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | Benzeneacetic acid, 2,3,4,5,6-pentafluoro-α-oxo- |
CAS: | 72331-54-5 |
EnglishSynonyms: | BENZENEACETIC ACID, 2,3,4,5,6-PENTAFLUORO-Α-OXO- |
pro_acceptors: | 0 |
pro_donors: | 0 |
pro_smile: | FC1=C(C(=C(C(=C1F)F)F)F)C(C(=O)O)=O |
InChi: | InChI=1S/C8HF5O3/c9-2-1(7(14)8(15)16)3(10)5(12)6(13)4(2)11/h(H,15,16) |
InChiKey: | InChIKey=LSBXSIGZDLYSIY-UHFFFAOYSA-N |
property |
|
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.