* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | Hexanoic acid, 6-amino-2-azido-, (2S)- |
CAS: | 2088916-76-9 |
EnglishSynonyms: | HEXANOIC ACID, 6-AMINO-2-AZIDO-, (2S)- |
pro_acceptors: | 0 |
pro_donors: | 0 |
pro_smile: | NCCCC[C@@H](C(=O)O)N=[N+]=[N-] |
InChi: | InChI=1S/C6H12N4O2/c7-4-2-1-3-5(6(11)12)9-10-8/h5H,1-4,7H2,(H,11,12)/t5-/m0/s1 |
InChiKey: | InChIKey=VCVVFUFHEYFMAK-YFKPBYRVSA-N |
property |
|
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.