* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ISOVALERALDEHYDE-1-13C |
| CAS: | 87994-87-4 |
| EnglishSynonyms: | ISOVALERALDEHYDE-1-13C ; 3-METHYLBUTANAL-1-13C |
| pro_mdlNumber: | MFCD00084021 |
| pro_acceptors: | 1 |
| pro_donors: | 0 |
| pro_smile: | CC(C)C[13CH]=O |
| InChi: | InChI=1S/C5H10O/c1-5(2)3-4-6/h4-5H,3H2,1-2H3/i4+1 |
| InChiKey: | InChIKey=YGHRJJRRZDOVPD-AZXPZELESA-N |
|
|
| Boiling_Point: | 90 DEG C(LIT) |
| Density: | DENSITY: 0.803 G/ML AT 25 DEG C |
| PhysicalProperty: | FLASHPOINT: -5 DEG C FLASHPOINT: 23 DEG F |
| Comments: | ASSAY METHOD: CP MASS SHIFT: M+1 RIDADR: UN 1989 3/PG 2 WGK: 1 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 87.12 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.