* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | L-THREONINE (U-13C4) |
| EnglishSynonyms: | L-THREONINE-13C4 ; L-THREONINE (U-13C4) |
| pro_mdlNumber: | MFCD00144681 |
| pro_acceptors: | 4 |
| pro_donors: | 3 |
| pro_smile: | [13CH3][13C@H]([13C@@H]([13C](=O)O)N)O |
| InChi: | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1/i1+1,2+1,3+1,4+1 |
| InChiKey: | InChIKey=AYFVYJQAPQTCCC-GGLUNYCGSA-N |
|
|
| MeltingPoint: | 256 DEG C(DEC) |
| Comments: | ASSAY METHOD: CP |
| Information: | ISOTOPIC PURITY: 98 ATOM % 13C MW: 123.01 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.