* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | L-TRYPTOPHAN (ALPHA-15N) |
| CAS: | 99404-62-3 |
| EnglishSynonyms: | L-TRYPTOPHAN (ALPHA-15N) ; L-TRYPTOPHAN-(AMINO-15N) |
| pro_mdlNumber: | MFCD00144683 |
| pro_acceptors: | 4 |
| pro_donors: | 3 |
| pro_smile: | c1ccc2c(c1)c(c[nH]2)C[C@@H](C(=O)O)[15NH2] |
| InChi: | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1/i12+1 |
| InChiKey: | InChIKey=QIVBCDIJIAJPQS-ZNXOOWLZSA-N |
|
|
| MeltingPoint: | 280-285 DEG C (DEC)(LIT) |
| Comments: | MASS SHIFT: M+1 OPTICAL ACTIVITY: [ALPHA]20/D -30.5 DEG, C = 1 IN H2O WGK: 1 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 15N MW: 205.22 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.