* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL FL 0018 |
| EnglishSynonyms: | RARECHEM AL FL 0018 |
| pro_mdlNumber: | MFCD00204912 |
| pro_acceptors: | 12 |
| pro_donors: | 0 |
| pro_smile: | CN(CCN(C)/C=C/c1nnnn1c2ccc(cc2)OC)/C=C/c3nnnn3c4ccc(cc4)OC |
| InChi: | InChI=1S/C24H28N10O2/c1-31(15-13-23-25-27-29-33(23)19-5-9-21(35-3)10-6-19)17-18-32(2)16-14-24-26-28-30-34(24)20-7-11-22(36-4)12-8-20/h5-16H,17-18H2,1-4H3/b15-13+,16-14+ |
| InChiKey: | InChIKey=XYFYMBYIVIKDQH-WXUKJITCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.