* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL MS 0396 |
| EnglishSynonyms: | RARECHEM AL MS 0396 |
| pro_mdlNumber: | MFCD00605332 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CCCCCCCc1ccc(cc1)CC(=O)O |
| InChi: | InChI=1S/C15H22O2/c1-2-3-4-5-6-7-13-8-10-14(11-9-13)12-15(16)17/h8-11H,2-7,12H2,1H3,(H,16,17) |
| InChiKey: | InChIKey=IAKAZOZSRJNBFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.