* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AP KH 0149 |
| EnglishSynonyms: | RARECHEM AP KH 0149 |
| pro_mdlNumber: | MFCD00612512 |
| pro_acceptors: | 5 |
| pro_donors: | 3 |
| pro_smile: | c1ccc(c(c1)/C=C\2/C(=O)NC(=O)N2)O |
| InChi: | InChI=1S/C10H8N2O3/c13-8-4-2-1-3-6(8)5-7-9(14)12-10(15)11-7/h1-5,13H,(H2,11,12,14,15)/b7-5- |
| InChiKey: | InChIKey=GXPDYJIBYGLMKU-ALCCZGGFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.