* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1350 |
| EnglishSynonyms: | RARECHEM AL BO 1350 |
| pro_mdlNumber: | MFCD00661314 |
| pro_acceptors: | 8 |
| pro_donors: | 4 |
| pro_smile: | C(C(C(=O)O)C(=O)O)C(C(=O)O)C(=O)O |
| InChi: | InChI=1S/C7H8O8/c8-4(9)2(5(10)11)1-3(6(12)13)7(14)15/h2-3H,1H2,(H,8,9)(H,10,11)(H,12,13)(H,14,15) |
| InChiKey: | InChIKey=NJEVMKZODGWUQT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.