* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AX KI 5015 |
| EnglishSynonyms: | RARECHEM AX KI 5015 |
| pro_mdlNumber: | MFCD01749589 |
| pro_acceptors: | 3 |
| pro_donors: | 0 |
| pro_smile: | CCCCOC(=O)C1=CCC[N+](C1)(C)C.[I-] |
| InChi: | InChI=1S/C12H22NO2.HI/c1-4-5-9-15-12(14)11-7-6-8-13(2,3)10-11;/h7H,4-6,8-10H2,1-3H3;1H/q+1;/p-1 |
| InChiKey: | InChIKey=ONNAEFWZVLNWBJ-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.