* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | UKRORGSYN-BB BBV-34569886 |
| EnglishSynonyms: | L-PHENYLALANINE, 4-BROMO- ; UKRORGSYN-BB BBV-34591394 ; UKRORGSYN-BB BBV-34569886 |
| pro_mdlNumber: | MFCD01860559 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | N[C@@H](CC1=CC=C(Br)C=C1)C(O)=O |
| InChi: | InChI=1S/C9H10BrNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChiKey: | InChIKey=PEMUHKUIQHFMTH-QMMMGPOBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.