* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | DIBROMOACETIC ACID-1-13C |
| EnglishSynonyms: | DIBROMOACETIC ACID-1-13C |
| pro_mdlNumber: | MFCD04118155 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | C([13C](=O)O)(Br)Br |
| InChi: | InChI=1S/C2H2Br2O2/c3-1(4)2(5)6/h1H,(H,5,6)/i2+1 |
| InChiKey: | InChIKey=SIEILFNCEFEENQ-VQEHIDDOSA-N |
|
|
| MeltingPoint: | 32-38 DEG C(LIT) |
| Boiling_Point: | 128-130 DEG C/16 MMHG(LIT) |
| Density: | 2.382g/mLat25°C |
| PhysicalProperty: | FLASHPOINT: 113 DEG C FLASHPOINT: 235.4 DEG F |
| Comments: | ASSAY METHOD: CP MASS SHIFT: M+1 WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 218.83 BY ATOM % CALCULATION |
|
|
| secure_symbol: |
GHS05
GHS07
|
| secure_signal_word: | Danger |
| secure_risk_stmt: | H302 + H312 + H332-H314 |
| secure_cautionary_stmt: | P280-P305 + P351 + P338-P310 |
| secure_damage_code: | C,Xn |
| secure_risk_disclosure_stmt: | R:20/21/22-34 |
| secure_security_stmt: | S:26-36/37/39-45 |
| secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.