* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BO 1836 |
EnglishSynonyms: | RARECHEM AL BO 1836 |
pro_mdlNumber: | MFCD06208613 |
pro_acceptors: | 4 |
pro_donors: | 1 |
pro_smile: | COc1ccc(cc1)C(c2c(cc(cn2)C(F)(F)F)Cl)C(=O)O |
InChi: | InChI=1S/C15H11ClF3NO3/c1-23-10-4-2-8(3-5-10)12(14(21)22)13-11(16)6-9(7-20-13)15(17,18)19/h2-7,12H,1H3,(H,21,22) |
InChiKey: | InChIKey=QJWLSVMAPBKFBX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.