* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BP 1119 |
EnglishSynonyms: | RARECHEM AL BP 1119 |
pro_mdlNumber: | MFCD06209836 |
pro_acceptors: | 8 |
pro_donors: | 1 |
pro_smile: | CS(=O)(=O)c1ccc(c(c1)[N+](=O)[O-])/C(=C/O)/C2OCCO2 |
InChi: | InChI=1S/C12H13NO7S/c1-21(17,18)8-2-3-9(11(6-8)13(15)16)10(7-14)12-19-4-5-20-12/h2-3,6-7,12,14H,4-5H2,1H3/b10-7- |
InChiKey: | InChIKey=CVNFWBBNNJDQPD-YFHOEESVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.