* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BP 1123 |
EnglishSynonyms: | RARECHEM AL BP 1123 |
pro_mdlNumber: | MFCD06209840 |
pro_acceptors: | 3 |
pro_donors: | 0 |
pro_smile: | Cc1cc(c(n1c2c(cc(cc2Cl)C(F)(F)F)Cl)C)C3OCCO3 |
InChi: | InChI=1S/C16H14Cl2F3NO2/c1-8-5-11(15-23-3-4-24-15)9(2)22(8)14-12(17)6-10(7-13(14)18)16(19,20)21/h5-7,15H,3-4H2,1-2H3 |
InChiKey: | InChIKey=ISIHGYQQULNNTF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.