* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BP 1273 |
| EnglishSynonyms: | RARECHEM AL BP 1273 |
| pro_mdlNumber: | MFCD06209979 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | c1cc2c(cc1C3OCCO3)OCCCO2 |
| InChi: | InChI=1S/C12H14O4/c1-4-13-10-3-2-9(8-11(10)14-5-1)12-15-6-7-16-12/h2-3,8,12H,1,4-7H2 |
| InChiKey: | InChIKey=SHKDLFQRBAMRLW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.