* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BP 1275 |
EnglishSynonyms: | RARECHEM AL BP 1275 |
pro_mdlNumber: | MFCD06209981 |
pro_acceptors: | 3 |
pro_donors: | 0 |
pro_smile: | COc1ccc(c(c1C2OCCO2)F)F |
InChi: | InChI=1S/C10H10F2O3/c1-13-7-3-2-6(11)9(12)8(7)10-14-4-5-15-10/h2-3,10H,4-5H2,1H3 |
InChiKey: | InChIKey=UOAXGXXQBHXLTM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.