* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BT 0299 |
EnglishSynonyms: | RARECHEM AL BT 0299 |
pro_mdlNumber: | MFCD06211964 |
pro_acceptors: | 2 |
pro_donors: | 2 |
pro_smile: | c1cc(sc1c2ccc(s2)C(CCO)N)c3ccc(s3)Br.Cl |
InChi: | InChI=1S/C15H14BrNOS3.ClH/c16-15-6-5-14(21-15)13-4-3-12(20-13)11-2-1-10(19-11)9(17)7-8-18;/h1-6,9,18H,7-8,17H2;1H |
InChiKey: | InChIKey=ZAORTKJLNYSWME-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.