* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BT 0374 |
| EnglishSynonyms: | RARECHEM AL BT 0374 |
| pro_mdlNumber: | MFCD06212035 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | c1cc(cc(c1)I)C(CCO)N.Cl |
| InChi: | InChI=1S/C9H12INO.ClH/c10-8-3-1-2-7(6-8)9(11)4-5-12;/h1-3,6,9,12H,4-5,11H2;1H |
| InChiKey: | InChIKey=QCLADVYGAIFINE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.