* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BT 0459 |
EnglishSynonyms: | RARECHEM AL BT 0459 |
pro_mdlNumber: | MFCD06212116 |
pro_acceptors: | 6 |
pro_donors: | 2 |
pro_smile: | COCc1ccc(c(c1)[N+](=O)[O-])C(CCO)N.Cl |
InChi: | InChI=1S/C11H16N2O4.ClH/c1-17-7-8-2-3-9(10(12)4-5-14)11(6-8)13(15)16;/h2-3,6,10,14H,4-5,7,12H2,1H3;1H |
InChiKey: | InChIKey=PGKBUDSHSPDRRD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.